C16H15F4NO4S — CID 90534836
3-fluoro-N-[2-hydroxy-2-[4-(trifluoromethyl)phenyl]ethyl]-4-methoxybenzenesulfonamide (PubChem CID 90534836) has the molecular formula C16H15F4NO4S and a molecular weight of 393.36 g/mol. Its IUPAC name is 3-fluoro-N-[2-hydroxy-2-[4-(trifluoromethyl)phenyl]ethyl]-4-methoxybenzenesulfonamide.
| Compound Name | 3-fluoro-N-[2-hydroxy-2-[4-(trifluoromethyl)phenyl]ethyl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 90534836 |
| Molecular Formula | C16H15F4NO4S |
| Molecular Weight | 393.36 g/mol |
| Exact Mass | 393.07 |
| IUPAC Name | 3-fluoro-N-[2-hydroxy-2-[4-(trifluoromethyl)phenyl]ethyl]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCC(O)c2ccc(C(F)(F)F)cc2)cc1F |
| InChI | InChI=1S/C16H15F4NO4S/c1-25-15-7-6-12(8-13(15)17)26(23,24)21-9-14(22)10-2-4-11(5-3-10)16(18,19)20/h2-8,14,21-22H,9H2,1H3 |
| InChIKey | HKTFZGPFUICUNF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.36 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |