C19H18FNO4S — CID 95367229
3-fluoro-N-[(2S)-2-hydroxy-2-naphthalen-1-ylethyl]-4-methoxybenzenesulfonamide (PubChem CID 95367229) has the molecular formula C19H18FNO4S and a molecular weight of 375.42 g/mol. Its IUPAC name is 3-fluoro-N-[(2S)-2-hydroxy-2-naphthalen-1-ylethyl]-4-methoxybenzenesulfonamide.
| Compound Name | 3-fluoro-N-[(2S)-2-hydroxy-2-naphthalen-1-ylethyl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 95367229 |
| Molecular Formula | C19H18FNO4S |
| Molecular Weight | 375.42 g/mol |
| Exact Mass | 375.09 |
| IUPAC Name | 3-fluoro-N-[(2S)-2-hydroxy-2-naphthalen-1-ylethyl]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NC[C@@H](O)c2cccc3ccccc23)cc1F |
| InChI | InChI=1S/C19H18FNO4S/c1-25-19-10-9-14(11-17(19)20)26(23,24)21-12-18(22)16-8-4-6-13-5-2-3-7-15(13)16/h2-11,18,21-22H,12H2,1H3/t18-/m1/s1 |
| InChIKey | OZZKIOVJTHJWGW-GOSISDBHSA-N |
| XLogP | 3.00 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.42 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |