C13H14FNO4S2 — CID 90500313
3-fluoro-N-(2-hydroxy-2-thiophen-2-ylethyl)-4-methoxybenzenesulfonamide (PubChem CID 90500313) has the molecular formula C13H14FNO4S2 and a molecular weight of 331.39 g/mol. Its IUPAC name is 3-fluoro-N-(2-hydroxy-2-thiophen-2-ylethyl)-4-methoxybenzenesulfonamide.
| Compound Name | 3-fluoro-N-(2-hydroxy-2-thiophen-2-ylethyl)-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 90500313 |
| Molecular Formula | C13H14FNO4S2 |
| Molecular Weight | 331.39 g/mol |
| Exact Mass | 331.03 |
| IUPAC Name | 3-fluoro-N-(2-hydroxy-2-thiophen-2-ylethyl)-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCC(O)c2cccs2)cc1F |
| InChI | InChI=1S/C13H14FNO4S2/c1-19-12-5-4-9(7-10(12)14)21(17,18)15-8-11(16)13-3-2-6-20-13/h2-7,11,15-16H,8H2,1H3 |
| InChIKey | SOANVYHVENHWEX-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.39 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |