C16H16F3NO3S2 — CID 90581968
N-[2-hydroxy-2-(4-methylsulfanylphenyl)ethyl]-4-(trifluoromethyl)benzenesulfonamide (PubChem CID 90581968) has the molecular formula C16H16F3NO3S2 and a molecular weight of 391.44 g/mol. Its IUPAC name is N-[2-hydroxy-2-(4-methylsulfanylphenyl)ethyl]-4-(trifluoromethyl)benzenesulfonamide.
| Compound Name | N-[2-hydroxy-2-(4-methylsulfanylphenyl)ethyl]-4-(trifluoromethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 90581968 |
| Molecular Formula | C16H16F3NO3S2 |
| Molecular Weight | 391.44 g/mol |
| Exact Mass | 391.05 |
| IUPAC Name | N-[2-hydroxy-2-(4-methylsulfanylphenyl)ethyl]-4-(trifluoromethyl)benzenesulfonamide |
| SMILES | CSc1ccc(C(O)CNS(=O)(=O)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C16H16F3NO3S2/c1-24-13-6-2-11(3-7-13)15(21)10-20-25(22,23)14-8-4-12(5-9-14)16(17,18)19/h2-9,15,20-21H,10H2,1H3 |
| InChIKey | PHGOGTVJSFFCBO-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.44 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |