C15H16FNO3S2 — CID 97416938
2-fluoro-N-[(2R)-2-hydroxy-2-(4-methylsulfanylphenyl)ethyl]benzenesulfonamide (PubChem CID 97416938) has the molecular formula C15H16FNO3S2 and a molecular weight of 341.43 g/mol. Its IUPAC name is 2-fluoro-N-[(2R)-2-hydroxy-2-(4-methylsulfanylphenyl)ethyl]benzenesulfonamide.
| Compound Name | 2-fluoro-N-[(2R)-2-hydroxy-2-(4-methylsulfanylphenyl)ethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 97416938 |
| Molecular Formula | C15H16FNO3S2 |
| Molecular Weight | 341.43 g/mol |
| Exact Mass | 341.06 |
| IUPAC Name | 2-fluoro-N-[(2R)-2-hydroxy-2-(4-methylsulfanylphenyl)ethyl]benzenesulfonamide |
| SMILES | CSc1ccc([C@@H](O)CNS(=O)(=O)c2ccccc2F)cc1 |
| InChI | InChI=1S/C15H16FNO3S2/c1-21-12-8-6-11(7-9-12)14(18)10-17-22(19,20)15-5-3-2-4-13(15)16/h2-9,14,17-18H,10H2,1H3/t14-/m0/s1 |
| InChIKey | KKPPETWFSXWUSO-AWEZNQCLSA-N |
| XLogP | 2.56 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.43 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |