C12H12FNO3S2 — CID 90496558
2-fluoro-N-(2-hydroxy-2-thiophen-3-ylethyl)benzenesulfonamide (PubChem CID 90496558) has the molecular formula C12H12FNO3S2 and a molecular weight of 301.36 g/mol. Its IUPAC name is 2-fluoro-N-(2-hydroxy-2-thiophen-3-ylethyl)benzenesulfonamide.
| Compound Name | 2-fluoro-N-(2-hydroxy-2-thiophen-3-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 90496558 |
| Molecular Formula | C12H12FNO3S2 |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.02 |
| IUPAC Name | 2-fluoro-N-(2-hydroxy-2-thiophen-3-ylethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCC(O)c1ccsc1)c1ccccc1F |
| InChI | InChI=1S/C12H12FNO3S2/c13-10-3-1-2-4-12(10)19(16,17)14-7-11(15)9-5-6-18-8-9/h1-6,8,11,14-15H,7H2 |
| InChIKey | PUHJJQWWRXGZSX-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |