C12H11F2NO3S2 — CID 103916544
3,4-difluoro-N-(2-hydroxy-2-thiophen-3-ylethyl)benzenesulfonamide (PubChem CID 103916544) has the molecular formula C12H11F2NO3S2 and a molecular weight of 319.35 g/mol. Its IUPAC name is 3,4-difluoro-N-(2-hydroxy-2-thiophen-3-ylethyl)benzenesulfonamide.
| Compound Name | 3,4-difluoro-N-(2-hydroxy-2-thiophen-3-ylethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 103916544 |
| Molecular Formula | C12H11F2NO3S2 |
| Molecular Weight | 319.35 g/mol |
| Exact Mass | 319.01 |
| IUPAC Name | 3,4-difluoro-N-(2-hydroxy-2-thiophen-3-ylethyl)benzenesulfonamide |
| SMILES | O=S(=O)(NCC(O)c1ccsc1)c1ccc(F)c(F)c1 |
| InChI | InChI=1S/C12H11F2NO3S2/c13-10-2-1-9(5-11(10)14)20(17,18)15-6-12(16)8-3-4-19-7-8/h1-5,7,12,15-16H,6H2 |
| InChIKey | AZVPZUBAIFWBSN-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.35 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |