C14H16FNO3S2 — CID 99981347
4-fluoro-N-[(3R)-3-hydroxy-3-thiophen-3-ylpropyl]-3-methylbenzenesulfonamide (PubChem CID 99981347) has the molecular formula C14H16FNO3S2 and a molecular weight of 329.42 g/mol. Its IUPAC name is 4-fluoro-N-[(3R)-3-hydroxy-3-thiophen-3-ylpropyl]-3-methylbenzenesulfonamide.
| Compound Name | 4-fluoro-N-[(3R)-3-hydroxy-3-thiophen-3-ylpropyl]-3-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 99981347 |
| Molecular Formula | C14H16FNO3S2 |
| Molecular Weight | 329.42 g/mol |
| Exact Mass | 329.06 |
| IUPAC Name | 4-fluoro-N-[(3R)-3-hydroxy-3-thiophen-3-ylpropyl]-3-methylbenzenesulfonamide |
| SMILES | Cc1cc(S(=O)(=O)NCC[C@@H](O)c2ccsc2)ccc1F |
| InChI | InChI=1S/C14H16FNO3S2/c1-10-8-12(2-3-13(10)15)21(18,19)16-6-4-14(17)11-5-7-20-9-11/h2-3,5,7-9,14,16-17H,4,6H2,1H3/t14-/m1/s1 |
| InChIKey | CJVFFOMXEXDLQW-CQSZACIVSA-N |
| XLogP | 2.60 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.42 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |