C14H16ClNO4S2 — CID 86264143
3-chloro-N-(3-hydroxy-3-thiophen-3-ylpropyl)-4-methoxybenzenesulfonamide (PubChem CID 86264143) has the molecular formula C14H16ClNO4S2 and a molecular weight of 361.87 g/mol. Its IUPAC name is 3-chloro-N-(3-hydroxy-3-thiophen-3-ylpropyl)-4-methoxybenzenesulfonamide.
| Compound Name | 3-chloro-N-(3-hydroxy-3-thiophen-3-ylpropyl)-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 86264143 |
| Molecular Formula | C14H16ClNO4S2 |
| Molecular Weight | 361.87 g/mol |
| Exact Mass | 361.02 |
| IUPAC Name | 3-chloro-N-(3-hydroxy-3-thiophen-3-ylpropyl)-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCCC(O)c2ccsc2)cc1Cl |
| InChI | InChI=1S/C14H16ClNO4S2/c1-20-14-3-2-11(8-12(14)15)22(18,19)16-6-4-13(17)10-5-7-21-9-10/h2-3,5,7-9,13,16-17H,4,6H2,1H3 |
| InChIKey | ATVZMXQCCHPMPI-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.87 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |