C16H20ClNO4S2 — CID 122160833
3-chloro-N-(5-hydroxy-3-thiophen-3-ylpentyl)-4-methoxybenzenesulfonamide (PubChem CID 122160833) has the molecular formula C16H20ClNO4S2 and a molecular weight of 389.93 g/mol. Its IUPAC name is 3-chloro-N-(5-hydroxy-3-thiophen-3-ylpentyl)-4-methoxybenzenesulfonamide.
| Compound Name | 3-chloro-N-(5-hydroxy-3-thiophen-3-ylpentyl)-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 122160833 |
| Molecular Formula | C16H20ClNO4S2 |
| Molecular Weight | 389.93 g/mol |
| Exact Mass | 389.05 |
| IUPAC Name | 3-chloro-N-(5-hydroxy-3-thiophen-3-ylpentyl)-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCCC(CCO)c2ccsc2)cc1Cl |
| InChI | InChI=1S/C16H20ClNO4S2/c1-22-16-3-2-14(10-15(16)17)24(20,21)18-7-4-12(5-8-19)13-6-9-23-11-13/h2-3,6,9-12,18-19H,4-5,7-8H2,1H3 |
| InChIKey | USNXTSLJELOWQX-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.93 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |