C11H16ClNO5S — CID 62498134
3-chloro-N-[2-(2-hydroxyethoxy)ethyl]-4-methoxybenzenesulfonamide (PubChem CID 62498134) has the molecular formula C11H16ClNO5S and a molecular weight of 309.77 g/mol. Its IUPAC name is 3-chloro-N-[2-(2-hydroxyethoxy)ethyl]-4-methoxybenzenesulfonamide.
| Compound Name | 3-chloro-N-[2-(2-hydroxyethoxy)ethyl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 62498134 |
| Molecular Formula | C11H16ClNO5S |
| Molecular Weight | 309.77 g/mol |
| Exact Mass | 309.04 |
| IUPAC Name | 3-chloro-N-[2-(2-hydroxyethoxy)ethyl]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCCOCCO)cc1Cl |
| InChI | InChI=1S/C11H16ClNO5S/c1-17-11-3-2-9(8-10(11)12)19(15,16)13-4-6-18-7-5-14/h2-3,8,13-14H,4-7H2,1H3 |
| InChIKey | UXTFRDHJWOVPTM-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.77 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|