C12H18FNO5S — CID 104600565
3-fluoro-N-[3-(2-hydroxyethoxy)propyl]-4-methoxybenzenesulfonamide (PubChem CID 104600565) has the molecular formula C12H18FNO5S and a molecular weight of 307.34 g/mol. Its IUPAC name is 3-fluoro-N-[3-(2-hydroxyethoxy)propyl]-4-methoxybenzenesulfonamide.
| Compound Name | 3-fluoro-N-[3-(2-hydroxyethoxy)propyl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 104600565 |
| Molecular Formula | C12H18FNO5S |
| Molecular Weight | 307.34 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | 3-fluoro-N-[3-(2-hydroxyethoxy)propyl]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCCCOCCO)cc1F |
| InChI | InChI=1S/C12H18FNO5S/c1-18-12-4-3-10(9-11(12)13)20(16,17)14-5-2-7-19-8-6-15/h3-4,9,14-15H,2,5-8H2,1H3 |
| InChIKey | IRQJZBPFUQSRTP-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.34 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|