C18H22FNO5S — CID 90536544
3-fluoro-N-[2-(2-hydroxyethoxy)-2-(4-methylphenyl)ethyl]-4-methoxybenzenesulfonamide (PubChem CID 90536544) has the molecular formula C18H22FNO5S and a molecular weight of 383.44 g/mol. Its IUPAC name is 3-fluoro-N-[2-(2-hydroxyethoxy)-2-(4-methylphenyl)ethyl]-4-methoxybenzenesulfonamide.
| Compound Name | 3-fluoro-N-[2-(2-hydroxyethoxy)-2-(4-methylphenyl)ethyl]-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 90536544 |
| Molecular Formula | C18H22FNO5S |
| Molecular Weight | 383.44 g/mol |
| Exact Mass | 383.12 |
| IUPAC Name | 3-fluoro-N-[2-(2-hydroxyethoxy)-2-(4-methylphenyl)ethyl]-4-methoxybenzenesulfonamide |
| SMILES | COc1ccc(S(=O)(=O)NCC(OCCO)c2ccc(C)cc2)cc1F |
| InChI | InChI=1S/C18H22FNO5S/c1-13-3-5-14(6-4-13)18(25-10-9-21)12-20-26(22,23)15-7-8-17(24-2)16(19)11-15/h3-8,11,18,20-21H,9-10,12H2,1-2H3 |
| InChIKey | KAVIKCKTNQJGEF-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.44 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |