C18H23NO5S — CID 90536519
N-[2-(2-hydroxyethoxy)-2-(4-methylphenyl)ethyl]-2-methoxybenzenesulfonamide (PubChem CID 90536519) has the molecular formula C18H23NO5S and a molecular weight of 365.45 g/mol. Its IUPAC name is N-[2-(2-hydroxyethoxy)-2-(4-methylphenyl)ethyl]-2-methoxybenzenesulfonamide.
| Compound Name | N-[2-(2-hydroxyethoxy)-2-(4-methylphenyl)ethyl]-2-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 90536519 |
| Molecular Formula | C18H23NO5S |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.13 |
| IUPAC Name | N-[2-(2-hydroxyethoxy)-2-(4-methylphenyl)ethyl]-2-methoxybenzenesulfonamide |
| SMILES | COc1ccccc1S(=O)(=O)NCC(OCCO)c1ccc(C)cc1 |
| InChI | InChI=1S/C18H23NO5S/c1-14-7-9-15(10-8-14)17(24-12-11-20)13-19-25(21,22)18-6-4-3-5-16(18)23-2/h3-10,17,19-20H,11-13H2,1-2H3 |
| InChIKey | JPGIXTUTTBZBFG-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |