C13H20ClNO4S — CID 65113185
3-chloro-N-(2-ethyl-2-hydroxybutyl)-4-methoxybenzenesulfonamide (PubChem CID 65113185) has the molecular formula C13H20ClNO4S and a molecular weight of 321.83 g/mol. Its IUPAC name is 3-chloro-N-(2-ethyl-2-hydroxybutyl)-4-methoxybenzenesulfonamide.
| Compound Name | 3-chloro-N-(2-ethyl-2-hydroxybutyl)-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 65113185 |
| Molecular Formula | C13H20ClNO4S |
| Molecular Weight | 321.83 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 3-chloro-N-(2-ethyl-2-hydroxybutyl)-4-methoxybenzenesulfonamide |
| SMILES | CCC(O)(CC)CNS(=O)(=O)c1ccc(OC)c(Cl)c1 |
| InChI | InChI=1S/C13H20ClNO4S/c1-4-13(16,5-2)9-15-20(17,18)10-6-7-12(19-3)11(14)8-10/h6-8,15-16H,4-5,9H2,1-3H3 |
| InChIKey | QLIQESAKQZNPDO-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.83 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |