C14H22ClNO4S — CID 103835165
3-chloro-N-(3-ethyl-2-hydroxypentyl)-4-methoxybenzenesulfonamide (PubChem CID 103835165) has the molecular formula C14H22ClNO4S and a molecular weight of 335.85 g/mol. Its IUPAC name is 3-chloro-N-(3-ethyl-2-hydroxypentyl)-4-methoxybenzenesulfonamide.
| Compound Name | 3-chloro-N-(3-ethyl-2-hydroxypentyl)-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 103835165 |
| Molecular Formula | C14H22ClNO4S |
| Molecular Weight | 335.85 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | 3-chloro-N-(3-ethyl-2-hydroxypentyl)-4-methoxybenzenesulfonamide |
| SMILES | CCC(CC)C(O)CNS(=O)(=O)c1ccc(OC)c(Cl)c1 |
| InChI | InChI=1S/C14H22ClNO4S/c1-4-10(5-2)13(17)9-16-21(18,19)11-6-7-14(20-3)12(15)8-11/h6-8,10,13,16-17H,4-5,9H2,1-3H3 |
| InChIKey | TUNADTGLIZOFJQ-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.85 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |