C13H19ClN2O4S — CID 49244513
2-[(3-chloro-4-methoxyphenyl)sulfonylamino]-N-(2-methylpropyl)acetamide (PubChem CID 49244513) has the molecular formula C13H19ClN2O4S and a molecular weight of 334.83 g/mol. Its IUPAC name is 2-[(3-chloro-4-methoxyphenyl)sulfonylamino]-N-(2-methylpropyl)acetamide.
| Compound Name | 2-[(3-chloro-4-methoxyphenyl)sulfonylamino]-N-(2-methylpropyl)acetamide |
|---|---|
| PubChem CID | 49244513 |
| Molecular Formula | C13H19ClN2O4S |
| Molecular Weight | 334.83 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | 2-[(3-chloro-4-methoxyphenyl)sulfonylamino]-N-(2-methylpropyl)acetamide |
| SMILES | COc1ccc(S(=O)(=O)NCC(=O)NCC(C)C)cc1Cl |
| InChI | InChI=1S/C13H19ClN2O4S/c1-9(2)7-15-13(17)8-16-21(18,19)10-4-5-12(20-3)11(14)6-10/h4-6,9,16H,7-8H2,1-3H3,(H,15,17) |
| InChIKey | ZOOLVTWIUDDUKH-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.83 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |