C14H23ClN2O5S2 — CID 113065672
N-[2-[butan-2-yl(methylsulfonyl)amino]ethyl]-3-chloro-4-methoxybenzenesulfonamide (PubChem CID 113065672) has the molecular formula C14H23ClN2O5S2 and a molecular weight of 398.93 g/mol. Its IUPAC name is N-[2-[butan-2-yl(methylsulfonyl)amino]ethyl]-3-chloro-4-methoxybenzenesulfonamide.
| Compound Name | N-[2-[butan-2-yl(methylsulfonyl)amino]ethyl]-3-chloro-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 113065672 |
| Molecular Formula | C14H23ClN2O5S2 |
| Molecular Weight | 398.93 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | N-[2-[butan-2-yl(methylsulfonyl)amino]ethyl]-3-chloro-4-methoxybenzenesulfonamide |
| SMILES | CCC(C)N(CCNS(=O)(=O)c1ccc(OC)c(Cl)c1)S(C)(=O)=O |
| InChI | InChI=1S/C14H23ClN2O5S2/c1-5-11(2)17(23(4,18)19)9-8-16-24(20,21)12-6-7-14(22-3)13(15)10-12/h6-7,10-11,16H,5,8-9H2,1-4H3 |
| InChIKey | OIQLEFVMJLBVNN-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.93 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |