C14H24N2O4S2 — CID 113065645
N-[2-[butan-2-yl(methylsulfonyl)amino]ethyl]-4-methylbenzenesulfonamide (PubChem CID 113065645) has the molecular formula C14H24N2O4S2 and a molecular weight of 348.49 g/mol. Its IUPAC name is N-[2-[butan-2-yl(methylsulfonyl)amino]ethyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[2-[butan-2-yl(methylsulfonyl)amino]ethyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 113065645 |
| Molecular Formula | C14H24N2O4S2 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | N-[2-[butan-2-yl(methylsulfonyl)amino]ethyl]-4-methylbenzenesulfonamide |
| SMILES | CCC(C)N(CCNS(=O)(=O)c1ccc(C)cc1)S(C)(=O)=O |
| InChI | InChI=1S/C14H24N2O4S2/c1-5-13(3)16(21(4,17)18)11-10-15-22(19,20)14-8-6-12(2)7-9-14/h6-9,13,15H,5,10-11H2,1-4H3 |
| InChIKey | JJTFCNUMOJCCDJ-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |