C14H26N2O2S — CID 143460096
N-[2-(dimethylamino)ethyl]-4-methylbenzenesulfonamide;propane (PubChem CID 143460096) has the molecular formula C14H26N2O2S and a molecular weight of 286.44 g/mol. Its IUPAC name is N-[2-(dimethylamino)ethyl]-4-methylbenzenesulfonamide;propane.
| Compound Name | N-[2-(dimethylamino)ethyl]-4-methylbenzenesulfonamide;propane |
|---|---|
| PubChem CID | 143460096 |
| Molecular Formula | C14H26N2O2S |
| Molecular Weight | 286.44 g/mol |
| Exact Mass | 286.17 |
| IUPAC Name | N-[2-(dimethylamino)ethyl]-4-methylbenzenesulfonamide;propane |
| SMILES | CCC.Cc1ccc(S(=O)(=O)NCCN(C)C)cc1 |
| InChI | InChI=1S/C11H18N2O2S.C3H8/c1-10-4-6-11(7-5-10)16(14,15)12-8-9-13(2)3;1-3-2/h4-7,12H,8-9H2,1-3H3;3H2,1-2H3 |
| InChIKey | SNSHDJOUTCXBFQ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.44 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |