C24H36N2O4S2 — CID 12715316
4-methyl-N-[10-[(4-methylphenyl)sulfonylamino]decyl]benzenesulfonamide (PubChem CID 12715316) has the molecular formula C24H36N2O4S2 and a molecular weight of 480.70 g/mol. Its IUPAC name is 4-methyl-N-[10-[(4-methylphenyl)sulfonylamino]decyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[10-[(4-methylphenyl)sulfonylamino]decyl]benzenesulfonamide |
|---|---|
| PubChem CID | 12715316 |
| Molecular Formula | C24H36N2O4S2 |
| Molecular Weight | 480.70 g/mol |
| Exact Mass | 480.21 |
| IUPAC Name | 4-methyl-N-[10-[(4-methylphenyl)sulfonylamino]decyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCCCCCCCCCNS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C24H36N2O4S2/c1-21-11-15-23(16-12-21)31(27,28)25-19-9-7-5-3-4-6-8-10-20-26-32(29,30)24-17-13-22(2)14-18-24/h11-18,25-26H,3-10,19-20H2,1-2H3 |
| InChIKey | OTOUFLXSMOCJOU-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.70 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|