C14H21NO2S — CID 100928656
4-methyl-N-(5-methylhex-5-enyl)benzenesulfonamide (PubChem CID 100928656) has the molecular formula C14H21NO2S and a molecular weight of 267.39 g/mol. Its IUPAC name is 4-methyl-N-(5-methylhex-5-enyl)benzenesulfonamide.
| Compound Name | 4-methyl-N-(5-methylhex-5-enyl)benzenesulfonamide |
|---|---|
| PubChem CID | 100928656 |
| Molecular Formula | C14H21NO2S |
| Molecular Weight | 267.39 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | 4-methyl-N-(5-methylhex-5-enyl)benzenesulfonamide |
| SMILES | C=C(C)CCCCNS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C14H21NO2S/c1-12(2)6-4-5-11-15-18(16,17)14-9-7-13(3)8-10-14/h7-10,15H,1,4-6,11H2,2-3H3 |
| InChIKey | CJJZBBGULHVQCL-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.39 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|