C11H16FNO2S — CID 10933762
N-(4-fluorobutyl)-4-methylbenzenesulfonamide (PubChem CID 10933762) has the molecular formula C11H16FNO2S and a molecular weight of 245.32 g/mol. Its IUPAC name is N-(4-fluorobutyl)-4-methylbenzenesulfonamide.
| Compound Name | N-(4-fluorobutyl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 10933762 |
| Molecular Formula | C11H16FNO2S |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.09 |
| IUPAC Name | N-(4-fluorobutyl)-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCCCF)cc1 |
| InChI | InChI=1S/C11H16FNO2S/c1-10-4-6-11(7-5-10)16(14,15)13-9-3-2-8-12/h4-7,13H,2-3,8-9H2,1H3 |
| InChIKey | BBRQUJXVGDORQP-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|