C11H14F3NO2S — CID 138979627
4-methyl-N-(4,4,4-trifluorobutyl)benzenesulfonamide (PubChem CID 138979627) has the molecular formula C11H14F3NO2S and a molecular weight of 281.30 g/mol. Its IUPAC name is 4-methyl-N-(4,4,4-trifluorobutyl)benzenesulfonamide.
| Compound Name | 4-methyl-N-(4,4,4-trifluorobutyl)benzenesulfonamide |
|---|---|
| PubChem CID | 138979627 |
| Molecular Formula | C11H14F3NO2S |
| Molecular Weight | 281.30 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | 4-methyl-N-(4,4,4-trifluorobutyl)benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCCC(F)(F)F)cc1 |
| InChI | InChI=1S/C11H14F3NO2S/c1-9-3-5-10(6-4-9)18(16,17)15-8-2-7-11(12,13)14/h3-6,15H,2,7-8H2,1H3 |
| InChIKey | ONLOFAOHCUTDMW-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.30 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|