C11H14F3NO5S2 — CID 10992051
3-[(4-methylphenyl)sulfonylamino]propyl trifluoromethanesulfonate (PubChem CID 10992051) has the molecular formula C11H14F3NO5S2 and a molecular weight of 361.36 g/mol. Its IUPAC name is 3-[(4-methylphenyl)sulfonylamino]propyl trifluoromethanesulfonate.
| Compound Name | 3-[(4-methylphenyl)sulfonylamino]propyl trifluoromethanesulfonate |
|---|---|
| PubChem CID | 10992051 |
| Molecular Formula | C11H14F3NO5S2 |
| Molecular Weight | 361.36 g/mol |
| Exact Mass | 361.03 |
| IUPAC Name | 3-[(4-methylphenyl)sulfonylamino]propyl trifluoromethanesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)NCCCOS(=O)(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C11H14F3NO5S2/c1-9-3-5-10(6-4-9)21(16,17)15-7-2-8-20-22(18,19)11(12,13)14/h3-6,15H,2,7-8H2,1H3 |
| InChIKey | NKTACSDQTQLXCD-UHFFFAOYSA-N |
| XLogP | 1.53 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.36 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|