C22H34N4O4S2 — CID 10917846
4-methyl-N-[3-[2-[3-[(4-methylphenyl)sulfonylamino]propylamino]ethylamino]propyl]benzenesulfonamide (PubChem CID 10917846) has the molecular formula C22H34N4O4S2 and a molecular weight of 482.67 g/mol. Its IUPAC name is 4-methyl-N-[3-[2-[3-[(4-methylphenyl)sulfonylamino]propylamino]ethylamino]propyl]benzenesulfonamide.
| Compound Name | 4-methyl-N-[3-[2-[3-[(4-methylphenyl)sulfonylamino]propylamino]ethylamino]propyl]benzenesulfonamide |
|---|---|
| PubChem CID | 10917846 |
| Molecular Formula | C22H34N4O4S2 |
| Molecular Weight | 482.67 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | 4-methyl-N-[3-[2-[3-[(4-methylphenyl)sulfonylamino]propylamino]ethylamino]propyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCCNCCNCCCNS(=O)(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C22H34N4O4S2/c1-19-5-9-21(10-6-19)31(27,28)25-15-3-13-23-17-18-24-14-4-16-26-32(29,30)22-11-7-20(2)8-12-22/h5-12,23-26H,3-4,13-18H2,1-2H3 |
| InChIKey | QIIOUPZBMDEUOF-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 116.40 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.67 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|