C25H34N4O4S2 — CID 11555407
5-(dimethylamino)-N-[3-[3-[(4-methylphenyl)sulfonylamino]propylamino]propyl]naphthalene-1-sulfonamide (PubChem CID 11555407) has the molecular formula C25H34N4O4S2 and a molecular weight of 518.71 g/mol. Its IUPAC name is 5-(dimethylamino)-N-[3-[3-[(4-methylphenyl)sulfonylamino]propylamino]propyl]naphthalene-1-sulfonamide.
| Compound Name | 5-(dimethylamino)-N-[3-[3-[(4-methylphenyl)sulfonylamino]propylamino]propyl]naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 11555407 |
| Molecular Formula | C25H34N4O4S2 |
| Molecular Weight | 518.71 g/mol |
| Exact Mass | 518.20 |
| IUPAC Name | 5-(dimethylamino)-N-[3-[3-[(4-methylphenyl)sulfonylamino]propylamino]propyl]naphthalene-1-sulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCCNCCCNS(=O)(=O)c2cccc3c(N(C)C)cccc23)cc1 |
| InChI | InChI=1S/C25H34N4O4S2/c1-20-12-14-21(15-13-20)34(30,31)27-18-6-16-26-17-7-19-28-35(32,33)25-11-5-8-22-23(25)9-4-10-24(22)29(2)3/h4-5,8-15,26-28H,6-7,16-19H2,1-3H3 |
| InChIKey | JPXAGVILTBVLEQ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.71 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|