C26H43N3O5S — CID 155460184
N-[3-[2-[2-[3-(tert-butylamino)propoxy]ethoxy]ethoxy]propyl]-5-(dimethylamino)naphthalene-1-sulfonamide (PubChem CID 155460184) has the molecular formula C26H43N3O5S and a molecular weight of 509.71 g/mol. Its IUPAC name is N-[3-[2-[2-[3-(tert-butylamino)propoxy]ethoxy]ethoxy]propyl]-5-(dimethylamino)naphthalene-1-sulfonamide.
| Compound Name | N-[3-[2-[2-[3-(tert-butylamino)propoxy]ethoxy]ethoxy]propyl]-5-(dimethylamino)naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 155460184 |
| Molecular Formula | C26H43N3O5S |
| Molecular Weight | 509.71 g/mol |
| Exact Mass | 509.29 |
| IUPAC Name | N-[3-[2-[2-[3-(tert-butylamino)propoxy]ethoxy]ethoxy]propyl]-5-(dimethylamino)naphthalene-1-sulfonamide |
| SMILES | CN(C)c1cccc2c(S(=O)(=O)NCCCOCCOCCOCCCNC(C)(C)C)cccc12 |
| InChI | InChI=1S/C26H43N3O5S/c1-26(2,3)27-14-8-16-32-18-20-34-21-19-33-17-9-15-28-35(30,31)25-13-7-10-22-23(25)11-6-12-24(22)29(4)5/h6-7,10-13,27-28H,8-9,14-21H2,1-5H3 |
| InChIKey | XNQKSXYDFKABAO-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.71 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|