C18H21ClN6O3S — CID 101251643
N-[3-[(4-amino-6-chloro-1,3,5-triazin-2-yl)oxy]propyl]-5-(dimethylamino)naphthalene-1-sulfonamide (PubChem CID 101251643) has the molecular formula C18H21ClN6O3S and a molecular weight of 436.93 g/mol. Its IUPAC name is N-[3-[(4-amino-6-chloro-1,3,5-triazin-2-yl)oxy]propyl]-5-(dimethylamino)naphthalene-1-sulfonamide.
| Compound Name | N-[3-[(4-amino-6-chloro-1,3,5-triazin-2-yl)oxy]propyl]-5-(dimethylamino)naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 101251643 |
| Molecular Formula | C18H21ClN6O3S |
| Molecular Weight | 436.93 g/mol |
| Exact Mass | 436.11 |
| IUPAC Name | N-[3-[(4-amino-6-chloro-1,3,5-triazin-2-yl)oxy]propyl]-5-(dimethylamino)naphthalene-1-sulfonamide |
| SMILES | CN(C)c1cccc2c(S(=O)(=O)NCCCOc3nc(N)nc(Cl)n3)cccc12 |
| InChI | InChI=1S/C18H21ClN6O3S/c1-25(2)14-8-3-7-13-12(14)6-4-9-15(13)29(26,27)21-10-5-11-28-18-23-16(19)22-17(20)24-18/h3-4,6-9,21H,5,10-11H2,1-2H3,(H2,20,22,23,24) |
| InChIKey | RXYHESVFNLWVMG-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 123.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.93 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|