C17H23N3O3S2 — CID 10981814
5-(dimethylamino)-N-(4-nitrososulfanylpentyl)naphthalene-1-sulfonamide (PubChem CID 10981814) has the molecular formula C17H23N3O3S2 and a molecular weight of 381.52 g/mol. Its IUPAC name is 5-(dimethylamino)-N-(4-nitrososulfanylpentyl)naphthalene-1-sulfonamide.
| Compound Name | 5-(dimethylamino)-N-(4-nitrososulfanylpentyl)naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 10981814 |
| Molecular Formula | C17H23N3O3S2 |
| Molecular Weight | 381.52 g/mol |
| Exact Mass | 381.12 |
| IUPAC Name | 5-(dimethylamino)-N-(4-nitrososulfanylpentyl)naphthalene-1-sulfonamide |
| SMILES | CC(CCCNS(=O)(=O)c1cccc2c(N(C)C)cccc12)SN=O |
| InChI | InChI=1S/C17H23N3O3S2/c1-13(24-19-21)7-6-12-18-25(22,23)17-11-5-8-14-15(17)9-4-10-16(14)20(2)3/h4-5,8-11,13,18H,6-7,12H2,1-3H3 |
| InChIKey | FCBRLMYDAYCIOI-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 78.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.52 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|