C30H38N4O4S2 — CID 14008934
5-(dimethylamino)-N-[6-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]hexyl]naphthalene-1-sulfonamide (PubChem CID 14008934) has the molecular formula C30H38N4O4S2 and a molecular weight of 582.79 g/mol. Its IUPAC name is 5-(dimethylamino)-N-[6-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]hexyl]naphthalene-1-sulfonamide.
| Compound Name | 5-(dimethylamino)-N-[6-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]hexyl]naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 14008934 |
| Molecular Formula | C30H38N4O4S2 |
| Molecular Weight | 582.79 g/mol |
| Exact Mass | 582.23 |
| IUPAC Name | 5-(dimethylamino)-N-[6-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]hexyl]naphthalene-1-sulfonamide |
| SMILES | CN(C)c1cccc2c(S(=O)(=O)NCCCCCCNS(=O)(=O)c3cccc4c(N(C)C)cccc34)cccc12 |
| InChI | InChI=1S/C30H38N4O4S2/c1-33(2)27-17-9-15-25-23(27)13-11-19-29(25)39(35,36)31-21-7-5-6-8-22-32-40(37,38)30-20-12-14-24-26(30)16-10-18-28(24)34(3)4/h9-20,31-32H,5-8,21-22H2,1-4H3 |
| InChIKey | DLFQSNDQLGYLEQ-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 98.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.79 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|