C17H18N2O4S — CID 170856982
2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]ethyl prop-2-ynoate (PubChem CID 170856982) has the molecular formula C17H18N2O4S and a molecular weight of 346.41 g/mol. Its IUPAC name is 2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]ethyl prop-2-ynoate.
| Compound Name | 2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]ethyl prop-2-ynoate |
|---|---|
| PubChem CID | 170856982 |
| Molecular Formula | C17H18N2O4S |
| Molecular Weight | 346.41 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]ethyl prop-2-ynoate |
| SMILES | C#CC(=O)OCCNS(=O)(=O)c1cccc2c(N(C)C)cccc12 |
| InChI | InChI=1S/C17H18N2O4S/c1-4-17(20)23-12-11-18-24(21,22)16-10-6-7-13-14(16)8-5-9-15(13)19(2)3/h1,5-10,18H,11-12H2,2-3H3 |
| InChIKey | LQGGTFIAHFVAQN-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.41 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_5', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|