C17H22N2O4S — CID 100613997
methyl (2S)-3-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]-2-methylpropanoate (PubChem CID 100613997) has the molecular formula C17H22N2O4S and a molecular weight of 350.44 g/mol. Its IUPAC name is methyl (2S)-3-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]-2-methylpropanoate.
| Compound Name | methyl (2S)-3-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]-2-methylpropanoate |
|---|---|
| PubChem CID | 100613997 |
| Molecular Formula | C17H22N2O4S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.13 |
| IUPAC Name | methyl (2S)-3-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]-2-methylpropanoate |
| SMILES | COC(=O)[C@@H](C)CNS(=O)(=O)c1cccc2c(N(C)C)cccc12 |
| InChI | InChI=1S/C17H22N2O4S/c1-12(17(20)23-4)11-18-24(21,22)16-10-6-7-13-14(16)8-5-9-15(13)19(2)3/h5-10,12,18H,11H2,1-4H3/t12-/m0/s1 |
| InChIKey | YCIYVUZVPDFBEY-LBPRGKRZSA-N |
| XLogP | 1.99 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |