C19H24N2O6S — CID 3860107
diethyl 2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]propanedioate (PubChem CID 3860107) has the molecular formula C19H24N2O6S and a molecular weight of 408.48 g/mol. Its IUPAC name is diethyl 2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]propanedioate.
| Compound Name | diethyl 2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]propanedioate |
|---|---|
| PubChem CID | 3860107 |
| Molecular Formula | C19H24N2O6S |
| Molecular Weight | 408.48 g/mol |
| Exact Mass | 408.14 |
| IUPAC Name | diethyl 2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]propanedioate |
| SMILES | CCOC(=O)C(NS(=O)(=O)c1cccc2c(N(C)C)cccc12)C(=O)OCC |
| InChI | InChI=1S/C19H24N2O6S/c1-5-26-18(22)17(19(23)27-6-2)20-28(24,25)16-12-8-9-13-14(16)10-7-11-15(13)21(3)4/h7-12,17,20H,5-6H2,1-4H3 |
| InChIKey | WPJUZWNEIFOJJP-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.48 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|