C18H24N2O7S — CID 54562643
5-(dimethylamino)-N-[(2S,4R,5R)-1,4,5,6-tetrahydroxy-3-oxohexan-2-yl]naphthalene-1-sulfonamide (PubChem CID 54562643) has the molecular formula C18H24N2O7S and a molecular weight of 412.46 g/mol. Its IUPAC name is 5-(dimethylamino)-N-[(2S,4R,5R)-1,4,5,6-tetrahydroxy-3-oxohexan-2-yl]naphthalene-1-sulfonamide.
| Compound Name | 5-(dimethylamino)-N-[(2S,4R,5R)-1,4,5,6-tetrahydroxy-3-oxohexan-2-yl]naphthalene-1-sulfonamide |
|---|---|
| PubChem CID | 54562643 |
| Molecular Formula | C18H24N2O7S |
| Molecular Weight | 412.46 g/mol |
| Exact Mass | 412.13 |
| IUPAC Name | 5-(dimethylamino)-N-[(2S,4R,5R)-1,4,5,6-tetrahydroxy-3-oxohexan-2-yl]naphthalene-1-sulfonamide |
| SMILES | CN(C)c1cccc2c(S(=O)(=O)N[C@@H](CO)C(=O)[C@H](O)[C@H](O)CO)cccc12 |
| InChI | InChI=1S/C18H24N2O7S/c1-20(2)14-7-3-6-12-11(14)5-4-8-16(12)28(26,27)19-13(9-21)17(24)18(25)15(23)10-22/h3-8,13,15,18-19,21-23,25H,9-10H2,1-2H3/t13-,15+,18+/m0/s1 |
| InChIKey | ZRPYXKNVIZVTRL-JCKWVBRZSA-N |
| XLogP | -1.17 |
| TPSA | 147.40 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.46 |
| LogP ≤ 5 | -1.17 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 8 |