C15H18N2O4S — CID 10829820
(2R)-2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino](114C)propanoic acid (PubChem CID 10829820) has the molecular formula C15H18N2O4S and a molecular weight of 324.38 g/mol. Its IUPAC name is (2R)-2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino](114C)propanoic acid.
| Compound Name | (2R)-2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino](114C)propanoic acid |
|---|---|
| PubChem CID | 10829820 |
| Molecular Formula | C15H18N2O4S |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.10 |
| IUPAC Name | (2R)-2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino](114C)propanoic acid |
| SMILES | C[C@@H](NS(=O)(=O)c1cccc2c(N(C)C)cccc12)[14C](=O)O |
| InChI | InChI=1S/C15H18N2O4S/c1-10(15(18)19)16-22(20,21)14-9-5-6-11-12(14)7-4-8-13(11)17(2)3/h4-10,16H,1-3H3,(H,18,19)/t10-/m1/s1/i15+2 |
| InChIKey | JCIYZTBXUJCAMW-XQCSRFCOSA-N |
| XLogP | 1.66 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |