C20H29N3O4S — CID 75059472
2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]propanoate;piperidin-1-ium (PubChem CID 75059472) has the molecular formula C20H29N3O4S and a molecular weight of 407.54 g/mol. Its IUPAC name is 2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]propanoate;piperidin-1-ium.
| Compound Name | 2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]propanoate;piperidin-1-ium |
|---|---|
| PubChem CID | 75059472 |
| Molecular Formula | C20H29N3O4S |
| Molecular Weight | 407.54 g/mol |
| Exact Mass | 407.19 |
| IUPAC Name | 2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]propanoate;piperidin-1-ium |
| SMILES | C1CC[NH2+]CC1.CC(NS(=O)(=O)c1cccc2c(N(C)C)cccc12)C(=O)[O-] |
| InChI | InChI=1S/C15H18N2O4S.C5H11N/c1-10(15(18)19)16-22(20,21)14-9-5-6-11-12(14)7-4-8-13(11)17(2)3;1-2-4-6-5-3-1/h4-10,16H,1-3H3,(H,18,19);6H,1-5H2 |
| InChIKey | YCUBRLRZPHPCLI-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 106.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.54 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |