C27H35N3O4S — CID 91872634
cyclohexylazanium;2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]-3-phenylpropanoate (PubChem CID 91872634) has the molecular formula C27H35N3O4S and a molecular weight of 497.66 g/mol. Its IUPAC name is cyclohexylazanium;2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]-3-phenylpropanoate.
| Compound Name | cyclohexylazanium;2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]-3-phenylpropanoate |
|---|---|
| PubChem CID | 91872634 |
| Molecular Formula | C27H35N3O4S |
| Molecular Weight | 497.66 g/mol |
| Exact Mass | 497.23 |
| IUPAC Name | cyclohexylazanium;2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]-3-phenylpropanoate |
| SMILES | CN(C)c1cccc2c(S(=O)(=O)NC(Cc3ccccc3)C(=O)[O-])cccc12.[NH3+]C1CCCCC1 |
| InChI | InChI=1S/C21H22N2O4S.C6H13N/c1-23(2)19-12-6-11-17-16(19)10-7-13-20(17)28(26,27)22-18(21(24)25)14-15-8-4-3-5-9-15;7-6-4-2-1-3-5-6/h3-13,18,22H,14H2,1-2H3,(H,24,25);6H,1-5,7H2 |
| InChIKey | UKQAFEXLDPTXCR-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 117.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.66 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |