C33H31I2N3O7S2 — CID 57339772
(2S)-2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]-3-[4-[5-(dimethylamino)naphthalen-1-yl]sulfonyloxy-3,5-diiodophenyl]propanoic acid (PubChem CID 57339772) has the molecular formula C33H31I2N3O7S2 and a molecular weight of 899.57 g/mol. Its IUPAC name is (2S)-2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]-3-[4-[5-(dimethylamino)naphthalen-1-yl]sulfonyloxy-3,5-diiodophenyl]propanoic acid.
| Compound Name | (2S)-2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]-3-[4-[5-(dimethylamino)naphthalen-1-yl]sulfonyloxy-3,5-diiodophenyl]propanoic acid |
|---|---|
| PubChem CID | 57339772 |
| Molecular Formula | C33H31I2N3O7S2 |
| Molecular Weight | 899.57 g/mol |
| Exact Mass | 898.97 |
| IUPAC Name | (2S)-2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]-3-[4-[5-(dimethylamino)naphthalen-1-yl]sulfonyloxy-3,5-diiodophenyl]propanoic acid |
| SMILES | CN(C)c1cccc2c(S(=O)(=O)N[C@@H](Cc3cc(I)c(OS(=O)(=O)c4cccc5c(N(C)C)cccc45)c(I)c3)C(=O)O)cccc12 |
| InChI | InChI=1S/C33H31I2N3O7S2/c1-37(2)28-13-5-11-23-21(28)9-7-15-30(23)46(41,42)36-27(33(39)40)19-20-17-25(34)32(26(35)18-20)45-47(43,44)31-16-8-10-22-24(31)12-6-14-29(22)38(3)4/h5-18,27,36H,19H2,1-4H3,(H,39,40)/t27-/m0/s1 |
| InChIKey | UYXBUNPMAVKNBS-MHZLTWQESA-N |
| XLogP | 6.08 |
| TPSA | 133.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 899.57 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|