C29H29N3O8S2 — CID 51049508
(2S)-2-[(4-acetamidophenyl)sulfonylamino]-3-[4-[5-(dimethylamino)naphthalen-1-yl]sulfonyloxyphenyl]propanoic acid (PubChem CID 51049508) has the molecular formula C29H29N3O8S2 and a molecular weight of 611.70 g/mol. Its IUPAC name is (2S)-2-[(4-acetamidophenyl)sulfonylamino]-3-[4-[5-(dimethylamino)naphthalen-1-yl]sulfonyloxyphenyl]propanoic acid.
| Compound Name | (2S)-2-[(4-acetamidophenyl)sulfonylamino]-3-[4-[5-(dimethylamino)naphthalen-1-yl]sulfonyloxyphenyl]propanoic acid |
|---|---|
| PubChem CID | 51049508 |
| Molecular Formula | C29H29N3O8S2 |
| Molecular Weight | 611.70 g/mol |
| Exact Mass | 611.14 |
| IUPAC Name | (2S)-2-[(4-acetamidophenyl)sulfonylamino]-3-[4-[5-(dimethylamino)naphthalen-1-yl]sulfonyloxyphenyl]propanoic acid |
| SMILES | CC(=O)Nc1ccc(S(=O)(=O)N[C@@H](Cc2ccc(OS(=O)(=O)c3cccc4c(N(C)C)cccc34)cc2)C(=O)O)cc1 |
| InChI | InChI=1S/C29H29N3O8S2/c1-19(33)30-21-12-16-23(17-13-21)41(36,37)31-26(29(34)35)18-20-10-14-22(15-11-20)40-42(38,39)28-9-5-6-24-25(28)7-4-8-27(24)32(2)3/h4-17,26,31H,18H2,1-3H3,(H,30,33)(H,34,35)/t26-/m0/s1 |
| InChIKey | HKTYWHRZEGXFIM-SANMLTNESA-N |
| XLogP | 3.61 |
| TPSA | 159.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 611.70 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|