C18H20N2O6S — CID 2185120
(2R)-2-[[4-(ethoxycarbonylamino)phenyl]sulfonylamino]-3-phenylpropanoic acid (PubChem CID 2185120) has the molecular formula C18H20N2O6S and a molecular weight of 392.43 g/mol. Its IUPAC name is (2R)-2-[[4-(ethoxycarbonylamino)phenyl]sulfonylamino]-3-phenylpropanoic acid.
| Compound Name | (2R)-2-[[4-(ethoxycarbonylamino)phenyl]sulfonylamino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 2185120 |
| Molecular Formula | C18H20N2O6S |
| Molecular Weight | 392.43 g/mol |
| Exact Mass | 392.10 |
| IUPAC Name | (2R)-2-[[4-(ethoxycarbonylamino)phenyl]sulfonylamino]-3-phenylpropanoic acid |
| SMILES | CCOC(=O)Nc1ccc(S(=O)(=O)N[C@H](Cc2ccccc2)C(=O)O)cc1 |
| InChI | InChI=1S/C18H20N2O6S/c1-2-26-18(23)19-14-8-10-15(11-9-14)27(24,25)20-16(17(21)22)12-13-6-4-3-5-7-13/h3-11,16,20H,2,12H2,1H3,(H,19,23)(H,21,22)/t16-/m1/s1 |
| InChIKey | FEFRFGJGRCZESQ-MRXNPFEDSA-N |
| XLogP | 2.23 |
| TPSA | 121.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.43 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |