C23H25N3O6S2 — CID 30167679
(2R)-2-[(4-ethoxyphenyl)sulfonylamino]-3-phenyl-N-(4-sulfamoylphenyl)propanamide (PubChem CID 30167679) has the molecular formula C23H25N3O6S2 and a molecular weight of 503.60 g/mol. Its IUPAC name is (2R)-2-[(4-ethoxyphenyl)sulfonylamino]-3-phenyl-N-(4-sulfamoylphenyl)propanamide.
| Compound Name | (2R)-2-[(4-ethoxyphenyl)sulfonylamino]-3-phenyl-N-(4-sulfamoylphenyl)propanamide |
|---|---|
| PubChem CID | 30167679 |
| Molecular Formula | C23H25N3O6S2 |
| Molecular Weight | 503.60 g/mol |
| Exact Mass | 503.12 |
| IUPAC Name | (2R)-2-[(4-ethoxyphenyl)sulfonylamino]-3-phenyl-N-(4-sulfamoylphenyl)propanamide |
| SMILES | CCOc1ccc(S(=O)(=O)N[C@H](Cc2ccccc2)C(=O)Nc2ccc(S(N)(=O)=O)cc2)cc1 |
| InChI | InChI=1S/C23H25N3O6S2/c1-2-32-19-10-14-21(15-11-19)34(30,31)26-22(16-17-6-4-3-5-7-17)23(27)25-18-8-12-20(13-9-18)33(24,28)29/h3-15,22,26H,2,16H2,1H3,(H,25,27)(H2,24,28,29)/t22-/m1/s1 |
| InChIKey | GTTJOWWWWMATEG-JOCHJYFZSA-N |
| XLogP | 2.26 |
| TPSA | 144.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.60 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |