C23H22Cl2N2O4S — CID 43891475
N-(3,5-dichlorophenyl)-2-[(4-ethoxyphenyl)sulfonylamino]-3-phenylpropanamide (PubChem CID 43891475) has the molecular formula C23H22Cl2N2O4S and a molecular weight of 493.41 g/mol. Its IUPAC name is N-(3,5-dichlorophenyl)-2-[(4-ethoxyphenyl)sulfonylamino]-3-phenylpropanamide.
| Compound Name | N-(3,5-dichlorophenyl)-2-[(4-ethoxyphenyl)sulfonylamino]-3-phenylpropanamide |
|---|---|
| PubChem CID | 43891475 |
| Molecular Formula | C23H22Cl2N2O4S |
| Molecular Weight | 493.41 g/mol |
| Exact Mass | 492.07 |
| IUPAC Name | N-(3,5-dichlorophenyl)-2-[(4-ethoxyphenyl)sulfonylamino]-3-phenylpropanamide |
| SMILES | CCOc1ccc(S(=O)(=O)NC(Cc2ccccc2)C(=O)Nc2cc(Cl)cc(Cl)c2)cc1 |
| InChI | InChI=1S/C23H22Cl2N2O4S/c1-2-31-20-8-10-21(11-9-20)32(29,30)27-22(12-16-6-4-3-5-7-16)23(28)26-19-14-17(24)13-18(25)15-19/h3-11,13-15,22,27H,2,12H2,1H3,(H,26,28) |
| InChIKey | RRRJWROBFFXFNU-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.41 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |