C18H24N2O4S — CID 14029644
(2R)-2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]hexanoic acid (PubChem CID 14029644) has the molecular formula C18H24N2O4S and a molecular weight of 364.47 g/mol. Its IUPAC name is (2R)-2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]hexanoic acid.
| Compound Name | (2R)-2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]hexanoic acid |
|---|---|
| PubChem CID | 14029644 |
| Molecular Formula | C18H24N2O4S |
| Molecular Weight | 364.47 g/mol |
| Exact Mass | 364.15 |
| IUPAC Name | (2R)-2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]hexanoic acid |
| SMILES | CCCC[C@@H](NS(=O)(=O)c1cccc2c(N(C)C)cccc12)C(=O)O |
| InChI | InChI=1S/C18H24N2O4S/c1-4-5-10-15(18(21)22)19-25(23,24)17-12-7-8-13-14(17)9-6-11-16(13)20(2)3/h6-9,11-12,15,19H,4-5,10H2,1-3H3,(H,21,22)/t15-/m1/s1 |
| InChIKey | OGHUUPAEGJCGAK-OAHLLOKOSA-N |
| XLogP | 2.83 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.47 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |