C24H34Cl2N4O6S — CID 21155424
6-amino-2-[2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]propanoylamino]hexanoic acid;1,3-dichloropropan-2-one (PubChem CID 21155424) has the molecular formula C24H34Cl2N4O6S and a molecular weight of 577.53 g/mol. Its IUPAC name is 6-amino-2-[2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]propanoylamino]hexanoic acid;1,3-dichloropropan-2-one.
| Compound Name | 6-amino-2-[2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]propanoylamino]hexanoic acid;1,3-dichloropropan-2-one |
|---|---|
| PubChem CID | 21155424 |
| Molecular Formula | C24H34Cl2N4O6S |
| Molecular Weight | 577.53 g/mol |
| Exact Mass | 576.16 |
| IUPAC Name | 6-amino-2-[2-[[5-(dimethylamino)naphthalen-1-yl]sulfonylamino]propanoylamino]hexanoic acid;1,3-dichloropropan-2-one |
| SMILES | CC(NS(=O)(=O)c1cccc2c(N(C)C)cccc12)C(=O)NC(CCCCN)C(=O)O.O=C(CCl)CCl |
| InChI | InChI=1S/C21H30N4O5S.C3H4Cl2O/c1-14(20(26)23-17(21(27)28)10-4-5-13-22)24-31(29,30)19-12-7-8-15-16(19)9-6-11-18(15)25(2)3;4-1-3(6)2-5/h6-9,11-12,14,17,24H,4-5,10,13,22H2,1-3H3,(H,23,26)(H,27,28);1-2H2 |
| InChIKey | HWKHFSSBGBPCHN-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 158.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.53 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|