C23H33N3O6S — CID 91207280
(2S)-6-amino-2-[[5-(dimethylamino)naphthalen-1-yl]sulfonyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]hexanoic acid (PubChem CID 91207280) has the molecular formula C23H33N3O6S and a molecular weight of 479.60 g/mol. Its IUPAC name is (2S)-6-amino-2-[[5-(dimethylamino)naphthalen-1-yl]sulfonyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]hexanoic acid.
| Compound Name | (2S)-6-amino-2-[[5-(dimethylamino)naphthalen-1-yl]sulfonyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]hexanoic acid |
|---|---|
| PubChem CID | 91207280 |
| Molecular Formula | C23H33N3O6S |
| Molecular Weight | 479.60 g/mol |
| Exact Mass | 479.21 |
| IUPAC Name | (2S)-6-amino-2-[[5-(dimethylamino)naphthalen-1-yl]sulfonyl-[(2-methylpropan-2-yl)oxycarbonyl]amino]hexanoic acid |
| SMILES | CN(C)c1cccc2c(S(=O)(=O)N(C(=O)OC(C)(C)C)[C@@H](CCCCN)C(=O)O)cccc12 |
| InChI | InChI=1S/C23H33N3O6S/c1-23(2,3)32-22(29)26(19(21(27)28)12-6-7-15-24)33(30,31)20-14-9-10-16-17(20)11-8-13-18(16)25(4)5/h8-11,13-14,19H,6-7,12,15,24H2,1-5H3,(H,27,28)/t19-/m0/s1 |
| InChIKey | BJVBNZMJQILNQT-IBGZPJMESA-N |
| XLogP | 3.41 |
| TPSA | 130.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.60 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|