C20H22N2O3S — CID 598487
(2-amino-1-phenylethyl) 5-(dimethylamino)naphthalene-1-sulfonate (PubChem CID 598487) has the molecular formula C20H22N2O3S and a molecular weight of 370.47 g/mol. Its IUPAC name is (2-amino-1-phenylethyl) 5-(dimethylamino)naphthalene-1-sulfonate.
| Compound Name | (2-amino-1-phenylethyl) 5-(dimethylamino)naphthalene-1-sulfonate |
|---|---|
| PubChem CID | 598487 |
| Molecular Formula | C20H22N2O3S |
| Molecular Weight | 370.47 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | (2-amino-1-phenylethyl) 5-(dimethylamino)naphthalene-1-sulfonate |
| SMILES | CN(C)c1cccc2c(S(=O)(=O)OC(CN)c3ccccc3)cccc12 |
| InChI | InChI=1S/C20H22N2O3S/c1-22(2)18-12-6-11-17-16(18)10-7-13-20(17)26(23,24)25-19(14-21)15-8-4-3-5-9-15/h3-13,19H,14,21H2,1-2H3 |
| InChIKey | RBCMSRYIUGQOAY-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 72.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.47 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|