C18H24BrNO3S — CID 170856976
6-bromohexyl 5-(dimethylamino)naphthalene-1-sulfonate (PubChem CID 170856976) has the molecular formula C18H24BrNO3S and a molecular weight of 414.37 g/mol. Its IUPAC name is 6-bromohexyl 5-(dimethylamino)naphthalene-1-sulfonate.
| Compound Name | 6-bromohexyl 5-(dimethylamino)naphthalene-1-sulfonate |
|---|---|
| PubChem CID | 170856976 |
| Molecular Formula | C18H24BrNO3S |
| Molecular Weight | 414.37 g/mol |
| Exact Mass | 413.07 |
| IUPAC Name | 6-bromohexyl 5-(dimethylamino)naphthalene-1-sulfonate |
| SMILES | CN(C)c1cccc2c(S(=O)(=O)OCCCCCCBr)cccc12 |
| InChI | InChI=1S/C18H24BrNO3S/c1-20(2)17-11-7-10-16-15(17)9-8-12-18(16)24(21,22)23-14-6-4-3-5-13-19/h7-12H,3-6,13-14H2,1-2H3 |
| InChIKey | XIWURNRCDBHUOG-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.37 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|