C28H45NO5S — CID 159546843
5-[4-[2-[2-(5,5-dimethylhexoxy)ethoxy]ethoxy]butylsulfonyl]-N,N-dimethylnaphthalen-1-amine (PubChem CID 159546843) has the molecular formula C28H45NO5S and a molecular weight of 507.74 g/mol. Its IUPAC name is 5-[4-[2-[2-(5,5-dimethylhexoxy)ethoxy]ethoxy]butylsulfonyl]-N,N-dimethylnaphthalen-1-amine.
| Compound Name | 5-[4-[2-[2-(5,5-dimethylhexoxy)ethoxy]ethoxy]butylsulfonyl]-N,N-dimethylnaphthalen-1-amine |
|---|---|
| PubChem CID | 159546843 |
| Molecular Formula | C28H45NO5S |
| Molecular Weight | 507.74 g/mol |
| Exact Mass | 507.30 |
| IUPAC Name | 5-[4-[2-[2-(5,5-dimethylhexoxy)ethoxy]ethoxy]butylsulfonyl]-N,N-dimethylnaphthalen-1-amine |
| SMILES | CN(C)c1cccc2c(S(=O)(=O)CCCCOCCOCCOCCCCC(C)(C)C)cccc12 |
| InChI | InChI=1S/C28H45NO5S/c1-28(2,3)16-6-7-17-32-19-21-34-22-20-33-18-8-9-23-35(30,31)27-15-11-12-24-25(27)13-10-14-26(24)29(4)5/h10-15H,6-9,16-23H2,1-5H3 |
| InChIKey | MEXCPFWANCFEHX-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.74 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|