C26H38N2O3S — CID 59859524
(11-isocyano-11-methyldodecyl) 5-(dimethylamino)naphthalene-1-sulfonate (PubChem CID 59859524) has the molecular formula C26H38N2O3S and a molecular weight of 458.67 g/mol. Its IUPAC name is (11-isocyano-11-methyldodecyl) 5-(dimethylamino)naphthalene-1-sulfonate.
| Compound Name | (11-isocyano-11-methyldodecyl) 5-(dimethylamino)naphthalene-1-sulfonate |
|---|---|
| PubChem CID | 59859524 |
| Molecular Formula | C26H38N2O3S |
| Molecular Weight | 458.67 g/mol |
| Exact Mass | 458.26 |
| IUPAC Name | (11-isocyano-11-methyldodecyl) 5-(dimethylamino)naphthalene-1-sulfonate |
| SMILES | [C-]#[N+]C(C)(C)CCCCCCCCCCOS(=O)(=O)c1cccc2c(N(C)C)cccc12 |
| InChI | InChI=1S/C26H38N2O3S/c1-26(2,27-3)20-12-10-8-6-7-9-11-13-21-31-32(29,30)25-19-15-16-22-23(25)17-14-18-24(22)28(4)5/h14-19H,6-13,20-21H2,1-2,4-5H3 |
| InChIKey | UEXUJPBVBQZOJY-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 50.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.67 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|